Difference between revisions of "PWY-5754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
 +
* inchi key:
 +
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
 +
* common name:
 +
** N-formylkynurenine
 +
* molecular weight:
 +
** 236.227   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-Formyl-L-kynurenine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[2-AMINOACRYLATE]][c] '''+''' 1 [[HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-8665]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-cystathionine[c] '''=>''' 1 2-aminoprop-2-enoate[c] '''+''' 1 L-homocysteine[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008829001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
+
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 1022-31-7
−
{{#set: gene associated=CHC_T00008829001_1}}
+
* PUBCHEM:
−
{{#set: in pathway=HOMOSER-METSYN-PWY|PWY-801|PWY-702}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
 +
* HMDB : HMDB60485
 +
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
 +
{{#set: common name=N-formylkynurenine}}
 +
{{#set: molecular weight=236.227    }}
 +
{{#set: common name=N-Formyl-L-kynurenine}}
 +
{{#set: produced by=RXN-8665}}

Revision as of 11:34, 18 January 2018

Metabolite N-FORMYLKYNURENINE

  • smiles:
    • [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
  • inchi key:
    • InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
  • common name:
    • N-formylkynurenine
  • molecular weight:
    • 236.227
  • Synonym(s):
    • N-Formyl-L-kynurenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-5754&oldid=8717"