Difference between revisions of "GLYMALTOPHOSPHORYL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7745 RXN-7745] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7745 RXN-7745] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-7066]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[NADH]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 NAD+[c] '''+''' 1 (2R,3S)-3-methylmalate[c] '''=>''' 1 2-oxobutanoate[c] '''+''' 1 CO2[c] '''+''' 1 NADH[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009162001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | * [[CHC_T00009293001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | * [[CHC_T00008852001_1]] | ||
+ | ** [[pantograph]]-[[a.taliana]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5101]], L-isoleucine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5101 PWY-5101] | ||
+ | ** '''4''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[a.taliana]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32718 32718] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00994 R00994] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.1.1}} |
− | + | {{#set: gene associated=CHC_T00009162001_1|CHC_T00009293001_1|CHC_T00008852001_1}} | |
− | + | {{#set: in pathway=PWY-5101}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | {{#set: reconstruction source=a.taliana}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 11:34, 18 January 2018
Contents
Reaction RXN-7745
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 CPD-7066[c] => 1 2-OXOBUTANOATE[c] + 1 CARBON-DIOXIDE[c] + 1 NADH[c]
- With common name(s):
- 1 NAD+[c] + 1 (2R,3S)-3-methylmalate[c] => 1 2-oxobutanoate[c] + 1 CO2[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5101, L-isoleucine biosynthesis II: PWY-5101
- 4 reactions found over 8 reactions in the full pathway
Reconstruction information
External links