Difference between revisions of "RXN-14285"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00005836001_1 == * Synonym(s): == Reactions associated == * 3.4.19.12-RXN ** pantograph-galdieria.sulphuraria == Pathways associate...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == |
+ | * smiles: | ||
+ | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N | ||
+ | * common name: | ||
+ | ** episterol | ||
+ | * molecular weight: | ||
+ | ** 398.671 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN3O-218]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN3O-203]] |
+ | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777] | ||
+ | * HMDB : HMDB06847 | ||
+ | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}} | ||
+ | {{#set: common name=episterol}} | ||
+ | {{#set: molecular weight=398.671 }} | ||
+ | {{#set: consumed by=RXN3O-218}} | ||
+ | {{#set: produced by=RXN3O-203}} |
Revision as of 11:34, 18 January 2018
Contents
Metabolite EPISTEROL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
- inchi key:
- InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
- common name:
- episterol
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.