Difference between revisions of "CHC T00010321001 1"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6201 RXN-6201] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DSLZVSRJTYRBFB-LLEIAEIESA-L |
+ | * common name: | ||
+ | ** D-glucarate | ||
+ | * molecular weight: | ||
+ | ** 208.124 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** glucarate | ||
+ | ** D-glucaric acid | ||
+ | ** L-gularic acid | ||
+ | ** D-saccharic acid | ||
+ | ** D-glucosaccharic acid | ||
+ | ** saccharate | ||
+ | ** (D)-glucarate | ||
+ | ** D-saccharate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14225]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 87-73-0 |
− | ** [http:// | + | * METABOLIGHTS : MTBLC30612 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288393 5288393] |
− | + | * HMDB : HMDB29881 | |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00818 C00818] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4450583.html 4450583] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30612 30612] |
+ | * BIGG : glcr | ||
+ | {{#set: smiles=C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=DSLZVSRJTYRBFB-LLEIAEIESA-L}} | ||
+ | {{#set: common name=D-glucarate}} | ||
+ | {{#set: molecular weight=208.124 }} | ||
+ | {{#set: common name=glucarate|D-glucaric acid|L-gularic acid|D-saccharic acid|D-glucosaccharic acid|saccharate|(D)-glucarate|D-saccharate}} | ||
+ | {{#set: consumed or produced by=RXN-14225}} |
Revision as of 11:34, 18 January 2018
Contents
Metabolite D-GLUCARATE
- smiles:
- C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-]
- inchi key:
- InChIKey=DSLZVSRJTYRBFB-LLEIAEIESA-L
- common name:
- D-glucarate
- molecular weight:
- 208.124
- Synonym(s):
- glucarate
- D-glucaric acid
- L-gularic acid
- D-saccharic acid
- D-glucosaccharic acid
- saccharate
- (D)-glucarate
- D-saccharate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 87-73-0
- METABOLIGHTS : MTBLC30612
- PUBCHEM:
- HMDB : HMDB29881
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : glcr
"C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-" cannot be used as a page name in this wiki.