Difference between revisions of "CHC T00008734001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == |
* smiles: | * smiles: | ||
− | ** C= | + | ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8)))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J |
* common name: | * common name: | ||
− | ** | + | ** ferroheme b |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 614.482 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** protoheme IX |
− | ** | + | ** ferroprotoporphyrin IX |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[PROTOHEMEFERROCHELAT-RXN]] | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627] |
− | * | + | * BIGG : pheme |
− | + | {{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}} | |
− | + | {{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}} | |
− | + | {{#set: common name=ferroheme b}} | |
− | {{#set: smiles=C= | + | {{#set: molecular weight=614.482 }} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=protoheme IX|ferroprotoporphyrin IX}} |
− | {{#set: common name= | + | {{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}} |
− | {{#set: molecular weight= | + | {{#set: consumed or produced by=PROTOHEMEFERROCHELAT-RXN}} |
− | {{#set: common name= | + | |
− | {{#set: consumed by=RXN | + |
Revision as of 12:34, 18 January 2018
Contents
Metabolite PROTOHEME
- smiles:
- C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
- inchi key:
- InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
- common name:
- ferroheme b
- molecular weight:
- 614.482
- Synonym(s):
- protoheme IX
- ferroprotoporphyrin IX
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- BIGG : pheme
"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.