Difference between revisions of "RXN-11575"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11575 RXN-11575] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11575 RXN-11575] ==
* smiles:
+
* direction:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
+
** [http://enzyme.expasy.org/EC/4.2.3.49 EC-4.2.3.49]
* common name:
+
** 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
+
* molecular weight:
+
** 428.697   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-17]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[FARNESYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-8843]][c]
* [[RXN66-16]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 (3R,6E)-nerolidol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5434]], (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5434 PWY-5434]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263319 44263319]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27534 27534]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87046 87046]
+
{{#set: ec number=EC-4.2.3.49}}
* HMDB : HMDB12168
+
{{#set: in pathway=PWY-5434}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction category=gap-filling}}
{{#set: inchi key=InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: common name=4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: reconstruction tool=meneco}}
{{#set: molecular weight=428.697    }}
+
{{#set: reconstruction comment=added for gapfilling}}
{{#set: consumed by=RXN66-17}}
+
{{#set: produced by=RXN66-16}}
+

Latest revision as of 14:51, 23 May 2018

Reaction RXN-11575

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 (2E,6E)-farnesyl diphosphate[c] => 1 diphosphate[c] + 1 (3R,6E)-nerolidol[c]

Genes associated with this reaction

Pathways

  • PWY-5434, (3E)-4,8-dimethylnona-1,3,7-triene biosynthesis: PWY-5434
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links