Difference between revisions of "CHC T00008413001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene CHC_T00008413001 == * left end position: ** 186468 * transcription direction: ** POSITIVE * right end position: ** 189446 * centisome position: ** 31...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008413001 == |
− | * | + | * left end position: |
− | ** | + | ** 186468 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 189446 |
− | * | + | * centisome position: |
− | ** | + | ** 31.8957 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ALPHAGALACTOSID-RXN]] | |
− | * [[RXN-11501]] | + | ** Source: [[annotation-original_genome]] |
− | * [[RXN-11502]] | + | *** Assignment: automated-name-match |
− | * [[RXN-12088]] | + | * Reaction: [[RXN-11501]] |
− | * [[RXN-17754]] | + | ** Source: [[annotation-original_genome]] |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN-11502]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-12088]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17754]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-17830]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6527]] | ||
+ | * [[PWY0-1301]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=186468}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=189446}} | |
− | + | {{#set: centisome position=31.8957 }} | |
− | + | {{#set: reaction associated=ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088|RXN-17754|RXN-17830}} | |
− | + | {{#set: pathway associated=PWY-6527|PWY0-1301}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 14:52, 23 May 2018
Gene CHC_T00008413001
- left end position:
- 186468
- transcription direction:
- POSITIVE
- right end position:
- 189446
- centisome position:
- 31.8957
- Synonym(s):
Reactions associated
- Reaction: ALPHAGALACTOSID-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-11501
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-11502
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-12088
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-17754
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN-17830
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome