Difference between revisions of "PWY-6654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] == * smiles: ** C1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=YCIMNLLNPGFGHC-...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654] ==
* smiles:
+
* taxonomic range:
** C1(C=CC(=C(C=1)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
* inchi key:
+
** InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** catechol
+
** phosphopantothenate biosynthesis III
* molecular weight:
+
** 110.112   
+
 
* Synonym(s):
 
* Synonym(s):
** pyrocatechol
 
** 2-hydroxyphenol
 
** pyrocatechin
 
** 1,2-dihydroxybenzene
 
** 1,2-benzenediol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
* [[RXN-3661]]
+
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00002917001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN-15635]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00001868001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11781 RXN-11781]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11782 RXN-11782]
 
== External links  ==
 
== External links  ==
* CAS : 120-80-9
+
{{#set: taxonomic range=TAX-2157}}
* DRUGBANK : DB02232
+
{{#set: common name=phosphopantothenate biosynthesis III}}
* PUBCHEM:
+
{{#set: reaction found=2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=289 289]
+
{{#set: total reaction=4}}
* HMDB : HMDB00957
+
{{#set: completion rate=50.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00090 C00090]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13837760.html 13837760]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18135 18135]
+
* METABOLIGHTS : MTBLC18135
+
{{#set: smiles=C1(C=CC(=C(C=1)O)O)}}
+
{{#set: inchi key=InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N}}
+
{{#set: common name=catechol}}
+
{{#set: molecular weight=110.112    }}
+
{{#set: common name=pyrocatechol|2-hydroxyphenol|pyrocatechin|1,2-dihydroxybenzene|1,2-benzenediol}}
+
{{#set: produced by=RXN-3661}}
+

Revision as of 14:52, 23 May 2018

Pathway PWY-6654

  • taxonomic range:
  • common name:
    • phosphopantothenate biosynthesis III
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links