Difference between revisions of "PWY-6707"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6707 PWY-6707] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** gallate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[CHC_T00007254001_1]] | ||
+ | *** [[CHC_T00008696001_1]] | ||
+ | *** [[CHC_T00009127001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12131 RXN-12131] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12132 RXN-12132] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=gallate biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:54, 23 May 2018
Pathway PWY-6707
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- 3-DEHYDROQUINATE-DEHYDRATASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated: