Difference between revisions of "CPD-700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00004379001_1 == * Synonym(s): == Reactions associated == * RXN-15556 ** pantograph-galdieria.sulphuraria * UBIQUITIN--PROTEIN-LI...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00004379001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
 +
* smiles:
 +
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
 +
* common name:
 +
** ergosta-5,7,24(28)-trien-3β-ol
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5,7,24(28)-ergostatrienol
 +
** 5-dehydro episterol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-15556]]
+
* [[RXN-707]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) known to produce the compound ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[RXN3O-218]]
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7511}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
 +
* HMDB : HMDB06848
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
 +
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
 +
{{#set: molecular weight=396.655    }}
 +
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
 +
{{#set: consumed by=RXN-707}}
 +
{{#set: produced by=RXN3O-218}}

Revision as of 14:55, 23 May 2018

Metabolite CPD-700

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
  • common name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • 5,7,24(28)-ergostatrienol
    • 5-dehydro episterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.