Difference between revisions of "TRANS-RXN1HP7-41"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] == * smiles: ** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-41 TRANS-RXN1HP7-41] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-694 CPD-694] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-41 TRANS-RXN1HP7-41] ==
* smiles:
+
* direction:
** CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H
+
 
* common name:
 
* common name:
** cob(I)yrinate a,c-diamide
+
** TRANS-RXN1HP7-41
* molecular weight:
+
** 931.9   
+
 
* Synonym(s):
 
* Synonym(s):
** cob(I)yrinic acid a,c-diamide
 
** Cob(I)yrinate diamide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R344-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[CO+2]][e] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[CO+2]][c] '''+''' 1.0 [[Pi]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 Co2+[e] '''+''' 1.0 ATP[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 Co2+[c] '''+''' 1.0 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00005840001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00002066001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266689 45266689]
+
{{#set: common name=TRANS-RXN1HP7-41}}
* CHEBI:
+
{{#set: gene associated=CHC_T00005840001_1|CHC_T00002066001_1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58575 58575]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C06505 C06505]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
* HMDB : HMDB06904
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CC6(=C7(C(C([CH]8(C2([N+]1([Co---]4([N+]3(C(=C(C)C=1C(CCC([O-])=O)C(CC(=O)N)(C)2)C(C(CCC(=O)[O-])C=3C=C5(C(C)(C)C(CCC(=O)[O-])C(=[N+]45)6))(CC(=O)N)C))N78))C))CC(=O)[O-])(C)CCC(=O)[O-]))}}
+
{{#set: inchi key=InChIKey=NKLHEMWEQJCPPF-OKJGWHJPSA-H}}
+
{{#set: common name=cob(I)yrinate a,c-diamide}}
+
{{#set: molecular weight=931.9    }}
+
{{#set: common name=cob(I)yrinic acid a,c-diamide|Cob(I)yrinate diamide}}
+
{{#set: consumed by=R344-RXN}}
+

Latest revision as of 15:56, 23 May 2018

Reaction TRANS-RXN1HP7-41

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • TRANS-RXN1HP7-41
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 Co2+[e] + 1.0 ATP[c] => 1.0 ADP[c] + 1.0 Co2+[c] + 1.0 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links