Difference between revisions of "Octanoylated-Gcv-H"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoylated-Gcv-H Octanoylated-Gcv-H] == * common name: ** a [glycine-cleavage complex H prote...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octanoylated-Gcv-H Octanoylated-Gcv-H] ==
−
* smiles:
+
−
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
+
** a [glycine-cleavage complex H protein] N6-octanoyl-L-lysine
−
* molecular weight:
+
−
** 354.213   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(5'-phosphoribitylamino)uracil
 
−
** 5-amino-6-(5-phosphoribitylamino)uracil
 
−
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14950]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* [[RXN-13037]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a [glycine-cleavage complex H protein] N6-octanoyl-L-lysine}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
+
{{#set: consumed by=RXN-14950}}
−
* CHEBI:
+
{{#set: produced by=RXN-13037}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
+
−
* BIGG : 5aprbu
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
+
−
* HMDB : HMDB03841
+
−
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
+
−
{{#set: molecular weight=354.213    }}
+
−
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
+
−
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}
+

Latest revision as of 14:57, 23 May 2018

Metabolite Octanoylated-Gcv-H

  • common name:
    • a [glycine-cleavage complex H protein] N6-octanoyl-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycine-cleavage complex H protein] N6-octanoyl-L-lysine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Octanoylated-Gcv-H&oldid=12697"