Difference between revisions of "CPD-9957"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MPT-Synthases MPT-Synthases] == * common name: ** a small subunit of molybdopterin synthase * S...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9957 CPD-9957] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** ubiquinol-9 |
+ | * molecular weight: | ||
+ | ** 797.255 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ubiquinol(9) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.1.1.64-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45281170 45281170] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84424 84424] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | ||
+ | {{#set: inchi key=InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N}} | ||
+ | {{#set: common name=ubiquinol-9}} | ||
+ | {{#set: molecular weight=797.255 }} | ||
+ | {{#set: common name=ubiquinol(9)}} | ||
+ | {{#set: produced by=2.1.1.64-RXN}} |
Revision as of 14:57, 23 May 2018
Contents
Metabolite CPD-9957
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- inchi key:
- InChIKey=NPCOQXAVBJJZBQ-WJNLUYJISA-N
- common name:
- ubiquinol-9
- molecular weight:
- 797.255
- Synonym(s):
- ubiquinol(9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links