Difference between revisions of "CPD-4575"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Supercoiled-Duplex-DNAs Supercoiled-Duplex-DNAs] == * common name: ** a supercoiled duplex DNA...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Supercoiled-Duplex-DNAs Supercoiled-Duplex-DNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] ==
 +
* smiles:
 +
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N
 
* common name:
 
* common name:
** a supercoiled duplex DNA
+
** 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol
 +
* molecular weight:
 +
** 428.697   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-4261]]
+
* [[RXN66-311]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN66-310]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a supercoiled duplex DNA}}
+
* PUBCHEM:
{{#set: consumed by=RXN0-4261}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298936 22298936]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87289 87289]
 +
* HMDB : HMDB12170
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N}}
 +
{{#set: common name=4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: molecular weight=428.697    }}
 +
{{#set: consumed by=RXN66-311}}
 +
{{#set: produced by=RXN66-310}}

Revision as of 14:58, 23 May 2018

Metabolite CPD-4575

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=LEUVIESGHNFBEK-WKYRUEGDSA-N
  • common name:
    • 4α-hydroxymethyl-4β-methyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 428.697
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.