Difference between revisions of "COUMARYL-ALCOHOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-2Fe-2S-Ferredoxins Reduced-2Fe-2S-Ferredoxins] == * common name: ** a reduced [2Fe-2S]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == |
| + | * smiles: | ||
| + | ** C(=CC1(=CC=C(O)C=C1))CO | ||
| + | * inchi key: | ||
| + | ** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-coumaryl alcohol |
| + | * molecular weight: | ||
| + | ** 150.177 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** p-coumaryl alcohol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-1102]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646] | ||
| + | * HMDB : HMDB03654 | ||
| + | {{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}} | ||
| + | {{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}} | ||
| + | {{#set: common name=4-coumaryl alcohol}} | ||
| + | {{#set: molecular weight=150.177 }} | ||
| + | {{#set: common name=p-coumaryl alcohol}} | ||
| + | {{#set: produced by=RXN-1102}} | ||
Revision as of 14:58, 23 May 2018
Contents
Metabolite COUMARYL-ALCOHOL
- smiles:
- C(=CC1(=CC=C(O)C=C1))CO
- inchi key:
- InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
- common name:
- 4-coumaryl alcohol
- molecular weight:
- 150.177
- Synonym(s):
- p-coumaryl alcohol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
