Difference between revisions of "CHC T00009453001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Gene == Gene CHC_T00008929001 == * left end position: ** 15781 * transcription direction: ** NEGATIVE * right end position: ** 17463 * centisome position: ** 29.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008929001 == |
− | * | + | * left end position: |
− | ** | + | ** 15781 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 17463 |
− | * | + | * centisome position: |
− | ** | + | ** 29.817104 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ACETOLACTREDUCTOISOM-RXN]] | |
− | * [[ | + | ** original_genome |
− | == | + | ***automated-name-match |
+ | * [[ACETOOHBUTREDUCTOISOM-RXN]] | ||
+ | ** original_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[VALSYN-PWY]] | ||
+ | * [[PWY-5103]] | ||
+ | * [[PWY-7111]] | ||
+ | * [[ILEUSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=15781}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=17463}} | |
− | + | {{#set: centisome position=29.817104 }} | |
− | + | {{#set: reaction associated=ACETOLACTREDUCTOISOM-RXN|ACETOOHBUTREDUCTOISOM-RXN}} | |
− | + | {{#set: pathway associated=VALSYN-PWY|PWY-5103|PWY-7111|ILEUSYN-PWY}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 10:49, 18 January 2018
Gene CHC_T00008929001
- left end position:
- 15781
- transcription direction:
- NEGATIVE
- right end position:
- 17463
- centisome position:
- 29.817104
- Synonym(s):
Reactions associated
- ACETOLACTREDUCTOISOM-RXN
- original_genome
- automated-name-match
- original_genome
- ACETOOHBUTREDUCTOISOM-RXN
- original_genome
- automated-name-match
- original_genome