Difference between revisions of "RXN-12293"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12293 RXN-12293] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12293 RXN-12293] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J
+
** [http://enzyme.expasy.org/EC/1.3.1 EC-1.3.1]
−
* common name:
+
−
** (E)-cinnamoyl-CoA
+
−
* molecular weight:
+
−
** 893.648   
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans-cinnamoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-2002]]
+
* With identifiers:
−
* [[RXN-7645]]
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-8847]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[MEK]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-2001]]
+
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 but-1-en-3-one[c] '''=>''' 1 NADP+[c] '''+''' 1 butan-2-one[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6786]], detoxification of reactive carbonyls in chloroplasts: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6786 PWY-6786]
 +
** '''1''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229143 44229143]
+
{{#set: ec number=EC-1.3.1}}
−
* CHEBI:
+
{{#set: in pathway=PWY-6786}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57252 57252]
+
{{#set: reconstruction category=gap-filling}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16256 C16256]
+
{{#set: reconstruction tool=meneco}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction comment=added for gapfilling}}
−
{{#set: inchi key=InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J}}
+
−
{{#set: common name=(E)-cinnamoyl-CoA}}
+
−
{{#set: molecular weight=893.648    }}
+
−
{{#set: common name=trans-cinnamoyl-CoA}}
+
−
{{#set: consumed by=RXN-2002|RXN-7645}}
+
−
{{#set: produced by=RXN-2001}}
+

Latest revision as of 14:58, 23 May 2018

Reaction RXN-12293

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H+[c] + 1 NADPH[c] + 1 but-1-en-3-one[c] => 1 NADP+[c] + 1 butan-2-one[c]

Genes associated with this reaction

Pathways

  • PWY-6786, detoxification of reactive carbonyls in chloroplasts: PWY-6786
    • 1 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12293&oldid=12777"