Difference between revisions of "CHC T00009251001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
(Created page with "Category:Gene == Gene CHC_T00009251001 == * left end position: ** 51 * transcription direction: ** NEGATIVE * right end position: ** 1337 * centisome position: ** 1.049598...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
+
== Gene CHC_T00009251001 ==
* smiles:
+
* left end position:
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 51
* inchi key:
+
* transcription direction:
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** 14-oxolanosterol
+
** 1337
* molecular weight:
+
* centisome position:
** 440.708    
+
** 1.0495987    
 
* Synonym(s):
 
* Synonym(s):
** 14-oxo-lanosterol
 
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN66-305]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
* [[RXN66-304]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=51}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21121725 21121725]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: right end position=1337}}
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
+
{{#set: centisome position=1.0495987   }}
{{#set: common name=14-oxolanosterol}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: molecular weight=440.708   }}
+
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: consumed by=RXN66-305}}
+
{{#set: produced by=RXN66-304}}
+

Latest revision as of 14:59, 23 May 2018

Gene CHC_T00009251001

  • left end position:
    • 51
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1337
  • centisome position:
    • 1.0495987
  • Synonym(s):

Reactions associated

Pathways associated

External links