Difference between revisions of "CPD-7109"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-Serine N-terminal-N-Ac-L-Serine] == * common name: ** an N-terminal Nα-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * smiles: ** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C * inchi key: **...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-N-Ac-L-Serine N-terminal-N-Ac-L-Serine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
 +
* smiles:
 +
** CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
 +
* inchi key:
 +
** InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
 
* common name:
 
* common name:
** an N-terminal Nα-acetyl-L-seryl-[protein]
+
** 4-prenylphlorisovalerophenone
 +
* molecular weight:
 +
** 277.339   
 
* Synonym(s):
 
* Synonym(s):
** a [protein] N-terminal Nα-acetyl-L-serine
+
** PPIVP
 +
** compound-X
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7810]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17863]]
+
* [[RXN-7811]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an N-terminal Nα-acetyl-L-seryl-[protein]}}
+
* PUBCHEM:
{{#set: common name=a [protein] N-terminal Nα-acetyl-L-serine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200610 25200610]
{{#set: produced by=RXN-17863}}
+
{{#set: smiles=CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C}}
 +
{{#set: inchi key=InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M}}
 +
{{#set: common name=4-prenylphlorisovalerophenone}}
 +
{{#set: molecular weight=277.339    }}
 +
{{#set: common name=PPIVP|compound-X}}
 +
{{#set: consumed by=RXN-7810}}
 +
{{#set: produced by=RXN-7811}}

Revision as of 14:59, 23 May 2018

Metabolite CPD-7109

  • smiles:
    • CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C
  • inchi key:
    • InChIKey=LWLGKGHHVBVDKB-UHFFFAOYSA-M
  • common name:
    • 4-prenylphlorisovalerophenone
  • molecular weight:
    • 277.339
  • Synonym(s):
    • PPIVP
    • compound-X

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCC1(=C(C=C(C(=C1O)C(CC(C)C)=O)O)[O-]))C" cannot be used as a page name in this wiki.