Difference between revisions of "PWY-7250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] ==
−
* smiles:
+
* taxonomic range:
−
** C(=CC1(=CC=C(O)C=C1))CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-2191]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-94695 TAX-94695]
−
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
 
* common name:
 
* common name:
−
** 4-coumaryl alcohol
+
** coenzyme M biosynthesis II
−
* molecular weight:
+
−
** 150.177   
+
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaryl alcohol
+
** CoM biosynthesis II
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''1''' reaction(s) found
−
* [[RXN-1102]]
+
** [[RXN-11737]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R233-RXN R233-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R232-RXN R232-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-11108 RXN-11108]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R234-RXN R234-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R231-RXN R231-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2191}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: taxonomic range=TAX-94695}}
−
* CHEMSPIDER:
+
{{#set: common name=coenzyme M biosynthesis II}}
−
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: common name=CoM biosynthesis II}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: reaction not found=5}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
−
* HMDB : HMDB03654
+
−
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
−
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
−
{{#set: common name=4-coumaryl alcohol}}
+
−
{{#set: molecular weight=150.177    }}
+
−
{{#set: common name=p-coumaryl alcohol}}
+
−
{{#set: produced by=RXN-1102}}
+

Revision as of 11:49, 18 January 2018

Pathway PWY-6643

  • taxonomic range:
  • common name:
    • coenzyme M biosynthesis II
  • Synonym(s):
    • CoM biosynthesis II

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7250&oldid=4917"