Difference between revisions of "3-terminal-unsaturated-sugars"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5847 CPD-5847] == * smiles: ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-terminal-unsaturated-sugars 3-terminal-unsaturated-sugars] == * common name: ** a 3'-terminal...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5847 CPD-5847] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-terminal-unsaturated-sugars 3-terminal-unsaturated-sugars] ==
* smiles:
+
** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))
+
* inchi key:
+
** InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N
+
 
* common name:
 
* common name:
** 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
+
** a 3'-terminal unsaturated sugar
* molecular weight:
+
** 430.713   
+
 
* Synonym(s):
 
* Synonym(s):
** β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6271]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.13.72-RXN]]
+
* [[4.2.99.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 3'-terminal unsaturated sugar}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459806 5459806]
+
{{#set: produced by=4.2.99.18-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4573575.html 4573575]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15717 15717]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04814 C04814]
+
{{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))}}
+
{{#set: inchi key=InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N}}
+
{{#set: common name=4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}}
+
{{#set: molecular weight=430.713    }}
+
{{#set: common name=β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}}
+
{{#set: consumed by=RXN-6271}}
+
{{#set: produced by=1.14.13.72-RXN}}
+

Latest revision as of 15:01, 23 May 2018

Metabolite 3-terminal-unsaturated-sugars

  • common name:
    • a 3'-terminal unsaturated sugar
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links