Difference between revisions of "PWY-7204"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7204 PWY-7204] ==
−
* smiles:
+
* taxonomic range:
−
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
 
* common name:
 
* common name:
−
** S-sulfo-L-cysteine
+
** pyridoxal 5'-phosphate salvage II (plants)
−
* molecular weight:
+
−
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-sulfocysteine
+
** vitamin B6 salvage (plants)
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''9''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.74-RXN]]
−
* [[SULFOCYS-RXN]]
+
** 1 associated gene(s):
 +
*** [[CHC_T00008718001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[PMPOXI-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008142001_1]]
 +
*** [[CHC_T00006254001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[PNKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004634001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PNPOXI-RXN]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00008142001_1]]
 +
*** [[CHC_T00006254001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[PYRAMKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004634001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[PYRIDOXKIN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00004634001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN-14046]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008718001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
* [[RXN-14181]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00008718001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-4-DEHYDROGENASE-RXN PYRIDOXINE-4-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
{{#set: common name=pyridoxal 5'-phosphate salvage II (plants)}}
−
* CHEBI:
+
{{#set: common name=vitamin B6 salvage (plants)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
{{#set: reaction found=8}}
−
* LIGAND-CPD:
+
{{#set: total reaction=9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
{{#set: completion rate=89.0}}
−
* HMDB : HMDB00731
+
−
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
−
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
−
{{#set: common name=S-sulfo-L-cysteine}}
+
−
{{#set: molecular weight=200.204    }}
+
−
{{#set: common name=S-sulfocysteine}}
+
−
{{#set: consumed or produced by=SULFOCYS-RXN}}
+

Revision as of 15:02, 23 May 2018

Pathway PWY-7204

  • taxonomic range:
  • common name:
    • pyridoxal 5'-phosphate salvage II (plants)
  • Synonym(s):
    • vitamin B6 salvage (plants)

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7204&oldid=12961"