Difference between revisions of "Protein-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00007340001_1 == * Synonym(s): == Reactions associated == * L-IDITOL-2-DEHYDROGENASE-RXN ** pantograph-galdieria.sulphuraria * RX...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * inc...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene CHC_T00007340001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] ==
 +
* smiles:
 +
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
 +
* inchi key:
 +
** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
 +
* common name:
 +
** shikimate 3-phosphate
 +
* molecular weight:
 +
** 251.109   
 
* Synonym(s):
 
* Synonym(s):
 +
** shikimate 5-phosphate
 +
** shikimate-5-P
 +
** 3-phosphoshikimate
 +
** shikimate-3-P
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-14249]]
+
* [[2.5.1.19-RXN]]
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[SHIKIMATE-KINASE-RXN]]
−
* [[RXN-7644]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
* [[THREODEHYD-RXN]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways associated ==
+
−
* [[THREONINE-DEG2-PWY]]
+
−
* [[THRDLCTCAT-PWY]]
+
−
* [[PWY-4101]]
+
−
* [[PWY-7378]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: reaction associated=L-IDITOL-2-DEHYDROGENASE-RXN|RXN-14249|RXN-7644|THREODEHYD-RXN}}
+
* PUBCHEM:
−
{{#set: pathway associated=THREONINE-DEG2-PWY|THRDLCTCAT-PWY|PWY-4101|PWY-7378}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989]
 +
* BIGG : skm5p
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175]
 +
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}}
 +
{{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}}
 +
{{#set: common name=shikimate 3-phosphate}}
 +
{{#set: molecular weight=251.109    }}
 +
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}}
 +
{{#set: consumed or produced by=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}}

Revision as of 10:49, 18 January 2018

Metabolite SHIKIMATE-5P

  • smiles:
    • C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
  • inchi key:
    • InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
  • common name:
    • shikimate 3-phosphate
  • molecular weight:
    • 251.109
  • Synonym(s):
    • shikimate 5-phosphate
    • shikimate-5-P
    • 3-phosphoshikimate
    • shikimate-3-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Protein-L-lysine&oldid=4934"