Difference between revisions of "CPD-5847"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acp] reduc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5847 CPD-5847] == * smiles: ** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9659 RXN-9659] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5847 CPD-5847] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))
 +
* inchi key:
 +
** InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N
 
* common name:
 
* common name:
−
** trans oct-2-enoyl-[acp] reductase
+
** 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 430.713   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-6271]]
−
** 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Octanoyl-ACPs]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[1.14.13.72-RXN]]
−
** 1 a trans oct-2-enoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 an octanoyl-[acp][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00009325001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans oct-2-enoyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459806 5459806]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CHEMSPIDER:
−
{{#set: gene associated=CHC_T00009325001_1}}
+
** [http://www.chemspider.com/Chemical-Structure.4573575.html 4573575]
−
{{#set: in pathway=PWY-5971}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15717 15717]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04814 C04814]
 +
{{#set: smiles=CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))}}
 +
{{#set: inchi key=InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N}}
 +
{{#set: common name=4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}}
 +
{{#set: molecular weight=430.713    }}
 +
{{#set: common name=β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol}}
 +
{{#set: consumed by=RXN-6271}}
 +
{{#set: produced by=1.14.13.72-RXN}}

Revision as of 15:03, 23 May 2018

Metabolite CPD-5847

  • smiles:
    • CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))
  • inchi key:
    • InChIKey=DWEXIFLNCXYYAA-QQHSWTODSA-N
  • common name:
    • 4β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol
  • molecular weight:
    • 430.713
  • Synonym(s):
    • β-hydroxymethyl-4α-methyl-5α-cholest-7-en-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)[CH]4(CC[CH]3(C(C)(CC[CH]2(C(=CC[CH]1(C(CO)(C)C(CCC(C)12)O))3))4))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-5847&oldid=13036"