Difference between revisions of "RXN-12193"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)N...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12193 RXN-12193] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-α-glucosyltransfera...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12193 RXN-12193] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I
+
 
* common name:
 
* common name:
** trans-2,3-dehydroadipyl-coA
+
** 4-α-glucosyltransferase
* molecular weight:
+
** Disproportionating Enzyme type 2
** 888.606   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.4.1.25 EC-2.4.1.25]
 
* Synonym(s):
 
* Synonym(s):
** cis-2,3-didehydroadipyl-CoA
 
** 2,3-didehydroadipyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[MALTOSE]][c] '''+''' 1 [[Maltodextrins]][c] '''=>''' 1 [[Glucopyranose]][c] '''+''' 1 [[Maltodextrins]][c]
* [[RXN-2425]]
+
* With common name(s):
 +
** 1 maltose[c] '''+''' 1 a maltodextrin[c] '''=>''' 1 D-glucopyranose[c] '''+''' 1 a maltodextrin[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009120001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00009120001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6737]], starch degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6737 PWY-6737]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679154 70679154]
+
{{#set: common name=4-α-glucosyltransferase}}
* CHEBI:
+
{{#set: common name=Disproportionating Enzyme type 2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71044 71044]
+
{{#set: ec number=EC-2.4.1.25}}
* LIGAND-CPD:
+
{{#set: gene associated=CHC_T00009120001_1|CHC_T00009120001}}
** [http://www.genome.jp/dbget-bin/www_bget?C14144 C14144]
+
{{#set: in pathway=PWY-6737}}
* HMDB : HMDB60392
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C=CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}}
{{#set: inchi key=InChIKey=ZFXICKRXPZTFPB-KCQRSJHASA-I}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: common name=trans-2,3-dehydroadipyl-coA}}
+
{{#set: molecular weight=888.606    }}
+
{{#set: common name=cis-2,3-didehydroadipyl-CoA|2,3-didehydroadipyl-CoA}}
+
{{#set: consumed or produced by=RXN-2425}}
+

Revision as of 15:03, 23 May 2018

Reaction RXN-12193

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4-α-glucosyltransferase
    • Disproportionating Enzyme type 2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6737, starch degradation V: PWY-6737
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links