Difference between revisions of "SULFO-CYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O |
| + | * inchi key: | ||
| + | ** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** S-sulfo-L-cysteine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 200.204 |
* Synonym(s): | * Synonym(s): | ||
| + | ** S-sulfocysteine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[SULFOCYS-RXN]] |
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824] |
| − | {{#set: smiles=C | + | * HMDB : HMDB00731 |
| − | {{#set: common name= | + | {{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}} |
| − | {{#set: | + | {{#set: common name=S-sulfo-L-cysteine}} |
| − | {{#set: | + | {{#set: molecular weight=200.204 }} |
| + | {{#set: common name=S-sulfocysteine}} | ||
| + | {{#set: reversible reaction associated=SULFOCYS-RXN}} | ||
Revision as of 15:04, 23 May 2018
Contents
Metabolite SULFO-CYSTEINE
- smiles:
- C(C([N+])C(=O)[O-])SS([O-])(=O)=O
- inchi key:
- InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
- common name:
- S-sulfo-L-cysteine
- molecular weight:
- 200.204
- Synonym(s):
- S-sulfocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([N+])C(=O)[O-])SS([O-])(=O)=O" cannot be used as a page name in this wiki.
