Difference between revisions of "13-HYDROPEROXYOCTADECA-911-DIENOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrohemoglobins Ferrohemoglobins] == * common name: ** a ferrohemoglobin * Synonym(s): == Rea...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROPEROXYOCTADECA-911-DIENOATE 13-HYDROPEROXYOCTADECA-911-DIENOATE] == * smiles: ** CCCCCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=13-HYDROPEROXYOCTADECA-911-DIENOATE 13-HYDROPEROXYOCTADECA-911-DIENOATE] == |
+ | * smiles: | ||
+ | ** CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO | ||
* common name: | * common name: | ||
− | ** | + | ** (13S)-HPODE |
+ | * inchi key: | ||
+ | ** InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M | ||
+ | * molecular weight: | ||
+ | ** 311.44 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate | ||
+ | ** (9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[HYDROHEX-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[LIPOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIPID_MAPS : LMFA01040001 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158461 21158461] | ||
+ | * HMDB : HMDB03871 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57466 57466] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04717 C04717] | ||
+ | {{#set: smiles=CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO}} | ||
+ | {{#set: common name=(13S)-HPODE}} | ||
+ | {{#set: inchi key=InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M}} | ||
+ | {{#set: molecular weight=311.44 }} | ||
+ | {{#set: common name=13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate|(9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate}} | ||
+ | {{#set: consumed by=HYDROHEX-RXN}} | ||
+ | {{#set: produced by=LIPOXYGENASE-RXN}} |
Revision as of 15:04, 23 May 2018
Contents
Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE
- smiles:
- CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO
- common name:
- (13S)-HPODE
- inchi key:
- InChIKey=JDSRHVWSAMTSSN-IRQZEAMPSA-M
- molecular weight:
- 311.44
- Synonym(s):
- 13(S)-hydroperoxy-9(Z),11(E)-octadecadienoate
- (9Z,11E)-(13S)-13-hydroperoxyoctadeca-9,11-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(C=CC=CCCCCCCCC(=O)[O-])OO" cannot be used as a page name in this wiki.