Difference between revisions of "RXN-1404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] == * smiles: ** C(C1(C=CC=CC=1))([O-])=O * common name: ** benzoate * inchi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] == * direction: ** LEFT-TO-RIGHT * common name: ** nitrilase * ec number: ** [ht...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOATE BENZOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] ==
−
* smiles:
+
* direction:
−
** C(C1(C=CC=CC=1))([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** benzoate
+
** nitrilase
−
* inchi key:
+
* ec number:
−
** InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/3.5.5.1 EC-3.5.5.1]
−
* molecular weight:
+
−
** 121.115   
+
 
* Synonym(s):
 
* Synonym(s):
−
** benzoic acid
 
−
** benzenecarboxylic acid
 
−
** phenylformic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-9336]]
+
** 1 [[INDOLEYL-CPD]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
** 1 indole-3-acetonitrile[c] '''+''' 2 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 indole-3-acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008379001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008379001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
 +
** '''2''' reactions found over '''13''' reactions in the full pathway
 +
* [[PWY-5026]], indole-3-acetate biosynthesis V (bacteria and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
* [[PWYQT-4476]], indole glucosinolate activation (herbivore attack): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476]
 +
** '''1''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-85-0
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03093 R03093]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=242 242]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01870
+
{{#set: common name=nitrilase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-3.5.5.1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00180 C00180]
+
{{#set: gene associated=CHC_T00008379001|CHC_T00008379001_1}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-581|PWY-5026|PWYQT-4476}}
−
** [http://www.chemspider.com/Chemical-Structure.237.html 237]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16150 16150]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* METABOLIGHTS : MTBLC16150
+
−
{{#set: smiles=C(C1(C=CC=CC=1))([O-])=O}}
+
−
{{#set: common name=benzoate}}
+
−
{{#set: inchi key=InChIKey=WPYMKLBDIGXBTP-UHFFFAOYSA-M}}
+
−
{{#set: molecular weight=121.115    }}
+
−
{{#set: common name=benzoic acid|benzenecarboxylic acid|phenylformic acid}}
+
−
{{#set: produced by=RXN-9336}}
+
−
{{#set: consumed or produced by=BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN}}
+

Revision as of 15:04, 23 May 2018

Reaction RXN-1404

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nitrilase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-581, indole-3-acetate biosynthesis II: PWY-581
    • 2 reactions found over 13 reactions in the full pathway
  • PWY-5026, indole-3-acetate biosynthesis V (bacteria and fungi): PWY-5026
    • 1 reactions found over 1 reactions in the full pathway
  • PWYQT-4476, indole glucosinolate activation (herbivore attack): PWYQT-4476
    • 1 reactions found over 13 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-1404&oldid=13111"