Difference between revisions of "3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008888001 == * left end position: ** 237594 * transcription direction: ** NEGATIVE * right end position: ** 239486 * centisome position: ** 41...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] == * smiles:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=YSZSVGFMAJXGMQ-FRICUITQSA-M |
− | * | + | * common name: |
− | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate |
− | * | + | * molecular weight: |
− | ** | + | ** 575.85 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-methoxy-4-hydroxy-5-hexaprenylbenzoate | ||
+ | ** 3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid | ||
+ | ** 3-hexaprenyl-4-hydroxy-5-methoxybenzoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[1. | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.1.1.114-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54692918 54692918] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.20171533.html 20171533] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57916 57916] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05313 C05313] | ||
+ | * HMDB : HMDB00977 | ||
+ | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=YSZSVGFMAJXGMQ-FRICUITQSA-M}} | ||
+ | {{#set: common name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}} | ||
+ | {{#set: molecular weight=575.85 }} | ||
+ | {{#set: common name=3-methoxy-4-hydroxy-5-hexaprenylbenzoate|3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-hexaprenyl-4-hydroxy-5-methoxybenzoate}} | ||
+ | {{#set: produced by=2.1.1.114-RXN}} |
Revision as of 15:05, 23 May 2018
Contents
Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C
- inchi key:
- InChIKey=YSZSVGFMAJXGMQ-FRICUITQSA-M
- common name:
- 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
- molecular weight:
- 575.85
- Synonym(s):
- 3-methoxy-4-hydroxy-5-hexaprenylbenzoate
- 3-(3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
- 3-hexaprenyl-4-hydroxy-5-methoxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C" cannot be used as a page name in this wiki.