Difference between revisions of "CHC T00009441001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
(Created page with "Category:Gene == Gene CHC_T00009441001 == * left end position: ** 185946 * transcription direction: ** NEGATIVE * right end position: ** 187322 * centisome position: ** 99...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Gene CHC_T00009441001 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 185946
−
* common name:
+
* transcription direction:
−
** protochlorophyllide a
+
** NEGATIVE
−
* molecular weight:
+
* right end position:
−
** 610.951    
+
** 187322
 +
* centisome position:
 +
** 99.106186    
 
* Synonym(s):
 
* Synonym(s):
−
** monovinyl protochlorophyllide a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ALLOPHANATE-HYDROLASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN1F-10]]
+
*** Assignment: automated-name-match
−
* [[RXN1F-72]]
+
== Pathways associated ==
 +
* [[PWY-5169]]
 +
* [[PWY-5703]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14751-08-7
+
{{#set: left end position=185946}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
+
{{#set: right end position=187322}}
−
* CHEBI:
+
{{#set: centisome position=99.106186   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
+
{{#set: reaction associated=ALLOPHANATE-HYDROLASE-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5169|PWY-5703}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
+
−
* HMDB : HMDB31148
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=protochlorophyllide a}}
+
−
{{#set: molecular weight=610.951   }}
+
−
{{#set: common name=monovinyl protochlorophyllide a}}
+
−
{{#set: consumed or produced by=RXN1F-10|RXN1F-72}}
+

Latest revision as of 15:06, 23 May 2018

Gene CHC_T00009441001

  • left end position:
    • 185946
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 187322
  • centisome position:
    • 99.106186
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009441001&oldid=13214"