Difference between revisions of "RXN-9537"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9537 RXN-9537] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9537 RXN-9537] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
−
* common name:
+
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
−
** ω-saturated C55 dolichol phosphate
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
−
* molecular weight:
+
−
** 849.311   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ω-saturated dolichol-11 phosphate
+
** (3R)-hydroxymyristoyl-ACP dehydratase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16602]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[R-3-hydroxymyristoyl-ACPs]][c] '''=>''' 1 [[Tetradec-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxymyristoyl-[acp][c] '''=>''' 1 a trans tetradec-2-enoyl-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''22''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: ec number=EC-4.2.1.59}}
−
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: common name=(3R)-hydroxymyristoyl-ACP dehydratase}}
−
{{#set: molecular weight=849.311    }}
+
{{#set: in pathway=PWY-5971|PWY-5994}}
−
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: reconstruction category=gap-filling}}
−
{{#set: consumed by=RXN-16602}}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
 +
{{#set: reconstruction tool=meneco}}
 +
{{#set: reconstruction comment=added for gapfilling}}

Revision as of 15:06, 23 May 2018

Reaction RXN-9537

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway
  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 22 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-9537&oldid=13221"