Difference between revisions of "5Z8Z11Z14Z17Z-EICOSAPENTAENOATE"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00009336001 == * left end position: ** 328046 * transcription direction: ** NEGATIVE * right end position: ** 329128 * centisome position: ** 74...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M |
− | * | + | * common name: |
− | ** | + | ** icosapentaenoate |
− | * | + | * molecular weight: |
− | ** | + | ** 301.448 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate | ||
+ | ** timnodonic acid | ||
+ | ** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate | ||
+ | ** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid | ||
+ | ** EPA | ||
+ | ** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate | ||
+ | ** eicosapentaenoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12978]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562] |
− | {{#set: | + | * Wikipedia : Eicosapentaenoate |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428] | ||
+ | * HMDB : HMDB01999 | ||
+ | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}} | ||
+ | {{#set: common name=icosapentaenoate}} | ||
+ | {{#set: molecular weight=301.448 }} | ||
+ | {{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}} | ||
+ | {{#set: consumed by=RXN-12978}} |
Revision as of 16:06, 23 May 2018
Contents
Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
- inchi key:
- InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
- common name:
- icosapentaenoate
- molecular weight:
- 301.448
- Synonym(s):
- (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
- timnodonic acid
- (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
- (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
- EPA
- (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
- eicosapentaenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-" cannot be used as a page name in this wiki.