Difference between revisions of "Reduced-2Fe-2S-Ferredoxins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.3.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.3.3.8 EC-5.3.3.8] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Trans-3-enoyl-CoAs]][c] '''<=>''' 1 [[TRANS-D2-ENOYL-COA]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a trans-3-enoyl-CoA[c] '''<=>''' 1 a trans-2-enoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[CHC_T00009422001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | * [[CHC_T00009349001_1]] | ||
+ | ** [[pantograph]]-[[galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-5138]], unsaturated, even numbered fatty acid β-oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138] | ||
+ | ** '''3''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[galdieria.sulphuraria]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: ec number=EC-5.3.3.8}} | |
− | {{#set: | + | {{#set: gene associated=CHC_T00009422001_1|CHC_T00009349001_1}} |
− | {{#set: | + | {{#set: in pathway=PWY-6837|PWY-5138}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=galdieria.sulphuraria}} |
Revision as of 11:50, 18 January 2018
Contents
Reaction RXN-7836
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Trans-3-enoyl-CoAs[c] <=> 1 TRANS-D2-ENOYL-COA[c]
- With common name(s):
- 1 a trans-3-enoyl-CoA[c] <=> 1 a trans-2-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6837, fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): PWY-6837
- 3 reactions found over 5 reactions in the full pathway
- PWY-5138, unsaturated, even numbered fatty acid β-oxidation: PWY-5138
- 3 reactions found over 5 reactions in the full pathway