Difference between revisions of "Reduced-2Fe-2S-Ferredoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/5.3.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(O)C(O)C(O)CCl
+
** REVERSIBLE
−
* inchi key:
+
* ec number:
−
** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
+
** [http://enzyme.expasy.org/EC/5.3.3.8 EC-5.3.3.8]
−
* common name:
+
−
** 5-chloro-5-deoxy-D-ribonate
+
−
* molecular weight:
+
−
** 183.568   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11717]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Trans-3-enoyl-CoAs]][c] '''<=>''' 1 [[TRANS-D2-ENOYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a trans-3-enoyl-CoA[c] '''<=>''' 1 a trans-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[CHC_T00009422001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
* [[CHC_T00009349001_1]]
 +
** [[pantograph]]-[[galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-5138]], unsaturated, even numbered fatty acid &beta;-oxidation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5138 PWY-5138]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[galdieria.sulphuraria]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
+
{{#set: ec number=EC-5.3.3.8}}
−
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
+
{{#set: gene associated=CHC_T00009422001_1|CHC_T00009349001_1}}
−
{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
+
{{#set: in pathway=PWY-6837|PWY-5138}}
−
{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=183.568    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-11717}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}

Revision as of 10:50, 18 January 2018

Reaction RXN-7836

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6837, fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): PWY-6837
    • 3 reactions found over 5 reactions in the full pathway
  • PWY-5138, unsaturated, even numbered fatty acid β-oxidation: PWY-5138
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Reduced-2Fe-2S-Ferredoxins&oldid=4959"