Difference between revisions of "CPD-7224"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9728 RXN-9728] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] == * smiles: ** CC(=O)NC(C([O-])=O)CCCNC(=O)N * inchi key: ** InChIKey=WMQMI...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9728 RXN-9728] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7224 CPD-7224] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(=O)NC(C([O-])=O)CCCNC(=O)N
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1]
+
** InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M
 +
* common name:
 +
** N-acetyl-L-citrulline
 +
* molecular weight:
 +
** 216.216   
 
* Synonym(s):
 
* Synonym(s):
 +
** acetyl-citrulline
 +
** N5-acetylcarbamoyl-L-ornithine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7933]]
** 1 [[MALONYL-COA]][c] '''+''' 1 [[Holo-malonate-decarboxylases]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[Malonate-Decarboxylases-Malonyl-Form]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 malonyl-CoA[c] '''+''' 1 [a holo malonate decarboxylase acyl-carrier-protein][c] '''=>''' 1 coenzyme A[c] '''+''' 1 a malonyl-[holo malonate decarboxylase acyl-carrier protein][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008765001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-5794]], malonate degradation I (biotin-independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5794 PWY-5794]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-2.3.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266759 45266759]
{{#set: gene associated=CHC_T00008765001_1}}
+
* CHEBI:
{{#set: in pathway=PWY-5794}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58765 58765]
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15532 C15532]
{{#set: reconstruction source=galdieria.sulphuraria}}
+
* HMDB : HMDB00856
 +
{{#set: smiles=CC(=O)NC(C([O-])=O)CCCNC(=O)N}}
 +
{{#set: inchi key=InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M}}
 +
{{#set: common name=N-acetyl-L-citrulline}}
 +
{{#set: molecular weight=216.216    }}
 +
{{#set: common name=acetyl-citrulline|N5-acetylcarbamoyl-L-ornithine}}
 +
{{#set: consumed by=RXN-7933}}

Revision as of 15:07, 23 May 2018

Metabolite CPD-7224

  • smiles:
    • CC(=O)NC(C([O-])=O)CCCNC(=O)N
  • inchi key:
    • InChIKey=WMQMIOYQXNRROC-LURJTMIESA-M
  • common name:
    • N-acetyl-L-citrulline
  • molecular weight:
    • 216.216
  • Synonym(s):
    • acetyl-citrulline
    • N5-acetylcarbamoyl-L-ornithine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC(C([O-])=O)CCCNC(=O)N" cannot be used as a page name in this wiki.