Difference between revisions of "PWY-6643"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9612 CPD-9612] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(=C(SC)C(=O)C1(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=2...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K |
* common name: | * common name: | ||
| − | ** | + | ** dGDP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 424.18 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxyguanosine-5'-diphosphate |
| + | ** deoxyguanosine-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14218]] |
| − | * [[ | + | * [[DGDPKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-748]] | ||
| + | * [[RXN-14217]] | ||
| + | * [[GDPREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14207]] | ||
== External links == | == External links == | ||
| + | * CAS : 102783-74-4 | ||
| + | * METABOLIGHTS : MTBLC58595 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245673 25245673] | ||
| + | * HMDB : HMDB00960 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00361 C00361] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58595 58595] |
| − | * | + | * BIGG : dgdp |
| − | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | |
| − | + | {{#set: inchi key=InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K}} | |
| − | {{#set: smiles= | + | {{#set: common name=dGDP}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=424.18 }} |
| − | {{#set: common name= | + | {{#set: common name=2'-deoxyguanosine-5'-diphosphate|deoxyguanosine-diphosphate}} |
| − | {{#set: molecular weight= | + | {{#set: consumed by=RXN-14218|DGDPKIN-RXN}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN0-748|RXN-14217|GDPREDUCT-RXN}} |
| − | {{#set: | + | {{#set: consumed or produced by=RXN-14207}} |
Revision as of 10:50, 18 January 2018
Contents
Metabolite DGDP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=CIKGWCTVFSRMJU-KVQBGUIXSA-K
- common name:
- dGDP
- molecular weight:
- 424.18
- Synonym(s):
- 2'-deoxyguanosine-5'-diphosphate
- deoxyguanosine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 102783-74-4
- METABOLIGHTS : MTBLC58595
- PUBCHEM:
- HMDB : HMDB00960
- LIGAND-CPD:
- CHEBI:
- BIGG : dgdp
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
