Difference between revisions of "CPD-15152"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N |
* common name: | * common name: | ||
− | ** | + | ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 683.068 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14177]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28423 28423] |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280835 5280835] |
− | {{#set: common name= | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N}} |
− | {{#set: | + | {{#set: common name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}} |
− | + | {{#set: molecular weight=683.068 }} | |
+ | {{#set: consumed by=RXN-14177}} |
Revision as of 15:11, 23 May 2018
Contents
Metabolite CPD-15152
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)
- inchi key:
- InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N
- common name:
- 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
- molecular weight:
- 683.068
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links