Difference between revisions of "TAURINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * smiles: ** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277] ==
−
* smiles:
+
* taxonomic range:
−
** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
+
 
* common name:
 
* common name:
−
** protoporphyrin IX
+
** superpathway of 5-aminoimidazole ribonucleotide biosynthesis
−
* molecular weight:
+
−
** 560.651   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN1F-20]]
+
* '''7''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[GARTRANSFORMYL2-RXN]]
−
* [[PROTOPORGENOXI-RXN]]
+
** [[PWY-6121]]
−
== Reaction(s) of unknown directionality ==
+
** [[GLYRIBONUCSYN-RXN]]
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
** [[AIRS-RXN]]
 +
** [[PRPPAMIDOTRANS-RXN]]
 +
** [[PWY-6122]]
 +
** [[FGAMSYN-RXN]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* CAS : 553-12-8
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6277 PWY-6277]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3794562 3794562]
+
{{#set: taxonomic range=TAX-2}}
−
* HMDB : HMDB00241
+
{{#set: common name=superpathway of 5-aminoimidazole ribonucleotide biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=7}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02191 C02191]
+
{{#set: reaction not found=0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.20171337.html 20171337]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57306 57306]
+
−
* BIGG : ppp9
+
−
{{#set: smiles=C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))}}
+
−
{{#set: inchi key=InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L}}
+
−
{{#set: common name=protoporphyrin IX}}
+
−
{{#set: molecular weight=560.651    }}
+
−
{{#set: consumed by=RXN1F-20}}
+
−
{{#set: produced by=PROTOPORGENOXI-RXN}}
+
−
{{#set: consumed or produced by=PROTOHEMEFERROCHELAT-RXN}}
+

Revision as of 11:46, 18 January 2018

Pathway PWY-6277

  • taxonomic range:
  • common name:
    • superpathway of 5-aminoimidazole ribonucleotide biosynthesis
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TAURINE&oldid=4470"