Difference between revisions of "CPD-15717"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42. ACECOATRANS-RXN-CPD-10280/ACET//TETRA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * inchi key:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15717 CPD-15717] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O |
+ | * inchi key: | ||
+ | ** InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N | ||
+ | * common name: | ||
+ | ** β-maltose | ||
+ | * molecular weight: | ||
+ | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** α-D-glucopyranose-(1→4)-β-D-glucopyranose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15909]] | |
− | + | * [[RXN-1827]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01971 C01971] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18147 18147] |
− | {{#set: | + | * METABOLIGHTS : MTBLC18147 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6255 6255] | ||
+ | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}} | ||
+ | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N}} | ||
+ | {{#set: common name=β-maltose}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=α-D-glucopyranose-(1→4)-β-D-glucopyranose}} | ||
+ | {{#set: produced by=RXN-15909|RXN-1827}} |
Revision as of 15:12, 23 May 2018
Contents
Metabolite CPD-15717
- smiles:
- C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QUYVBRFLSA-N
- common name:
- β-maltose
- molecular weight:
- 342.299
- Synonym(s):
- α-D-glucopyranose-(1→4)-β-D-glucopyranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links