Difference between revisions of "CHC T00008364001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...")
(Created page with "Category:Gene == Gene CHC_T00008364001 == * left end position: ** 98812 * transcription direction: ** NEGATIVE * right end position: ** 100704 * centisome position: ** 8.4...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14425 CPD-14425] ==
+
== Gene CHC_T00008364001 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 98812
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
+
** 100704
−
* molecular weight:
+
* centisome position:
−
** 1073.981    
+
** 8.428800    
 
* Synonym(s):
 
* Synonym(s):
−
** docosapentaenoyl-2-enoyl-CoA
 
−
** (2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13445]]
+
* Reaction: [[3.2.1.113-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN-13444]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=98812}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551532 72551532]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=100704}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76461 76461]
+
{{#set: centisome position=8.428800   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=3.2.1.113-RXN}}
−
{{#set: inchi key=InChIKey=HGVXUTAEZALTIG-HKHRKLHHSA-J}}
+
−
{{#set: common name=(2E,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1073.981   }}
+
−
{{#set: common name=docosapentaenoyl-2-enoyl-CoA|(2E,7Z,10Z,13Z,16Z,19Z)-docosa-2,7,10,13,16,19-hexaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-13445}}
+
−
{{#set: produced by=RXN-13444}}
+

Latest revision as of 15:13, 23 May 2018

Gene CHC_T00008364001

  • left end position:
    • 98812
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 100704
  • centisome position:
    • 8.428800
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008364001&oldid=13735"