Difference between revisions of "23S-rRNA-uridine2457"

Latest revision as of 15:14, 23 May 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-uridine2457 23S-rRNA-uridine2457] ==
-* smiles:
-** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
-* inchi key:
-** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
 * common name:
-** OPC4-CoA
+** uridine2457 in 23S rRNA
-* molecular weight:
-** 983.813
 * Synonym(s):
+** a 23S rRNA uridine2457
 == Reaction(s) known to consume the compound ==
-* [[RXN-10707]]
+* [[RXN-11834]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10700]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=uridine2457 in 23S rRNA}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
+{{#set: common name=a 23S rRNA uridine2457}}
-{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+{{#set: consumed by=RXN-11834}}
-{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
-{{#set: common name=OPC4-CoA}}
-{{#set: molecular weight=983.813    }}
-{{#set: consumed by=RXN-10707}}
-{{#set: produced by=RXN-10700}}