Difference between revisions of "Protein-pi-phospho-L-histidines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-pi-phospho-L-histidines Protein-pi-phospho-L-histidines] == * common name: ** a [protei...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-pi-phospho-L-histidines Protein-pi-phospho-L-histidines] ==
−
* smiles:
+
−
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
 
* common name:
 
* common name:
−
** (2E,7Z)-hexadecenoyl-CoA
+
** a [protein]-Nπ-phospho-L-histidine
−
* molecular weight:
+
−
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 16:2-Δ2,Δ7-CoA
+
** a [protein]-N-phosphohistidine
−
** 2-trans,7-cis-hexadecenoyl-CoA
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17780]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17779]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-15512]]
 +
* [[RXN-15509]]
 +
* [[RXN-15510]]
 +
* [[RXN-15511]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a [protein]-Nπ-phospho-L-histidine}}
−
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
{{#set: common name=a [protein]-N-phosphohistidine}}
−
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}}
−
{{#set: molecular weight=997.883    }}
+
−
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
−
{{#set: consumed by=RXN-17780}}
+
−
{{#set: produced by=RXN-17779}}
+

Revision as of 15:14, 23 May 2018

Metabolite Protein-pi-phospho-L-histidines

  • common name:
    • a [protein]-Nπ-phospho-L-histidine
  • Synonym(s):
    • a [protein]-N-phosphohistidine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-Nπ-phospho-L-histidine" cannot be used as a page name in this wiki.
"a [protein]-N-phosphohistidine" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Protein-pi-phospho-L-histidines&oldid=13791"