Difference between revisions of "CHC T00004285001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Gene == Gene CHC_T00004285001_1 == * Synonym(s): == Reactions associated == * Reaction: RIBOFLAVIN-SYN-RXN ** Source: orthology-galdieria.sulphuraria **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00004285001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RIBOFLAVIN-SYN-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6167]] | ||
+ | * [[PWY-6168]] | ||
+ | * [[RIBOSYN2-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RIBOFLAVIN-SYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6167|PWY-6168|RIBOSYN2-PWY}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 16:15, 23 May 2018
Gene CHC_T00004285001_1
- Synonym(s):
Reactions associated
- Reaction: RIBOFLAVIN-SYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana