Difference between revisions of "PWY0-862"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862] ==
* smiles:
+
* taxonomic range:
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
 
* common name:
 
* common name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** (5Z)-dodec-5-enoate biosynthesis
* molecular weight:
+
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
** di-trans,poly-cis-geranylgeranyl diphosphate
+
** (5Z)-dodecenoate biosynthesis
** ω,E,E,Z-geranylgeranyl diphosphate
+
** cis-dodecenoate biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[RXN-9655]]
* [[RXN0-5180]]
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN0-2141]]
 +
** 2 associated gene(s):
 +
*** [[CHC_T00009465001_1]]
 +
*** [[CHC_T00009465001]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
* [[RXN0-2142]]
 +
** 4 associated gene(s):
 +
*** [[CHC_T00008517001_1]]
 +
*** [[CHC_T00008496001]]
 +
*** [[CHC_T00008557001]]
 +
*** [[CHC_T00008477001]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
* [[RXN0-2145]]
 +
** 1 associated gene(s):
 +
*** [[CHC_T00009325001_1]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5.3.3.14-RXN 5.3.3.14-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-862 PWY0-862]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
{{#set: common name=(5Z)-dodec-5-enoate biosynthesis}}
* LIGAND-CPD:
+
{{#set: common name=(5Z)-dodecenoate biosynthesis|cis-dodecenoate biosynthesis}}
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
{{#set: reaction found=4}}
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: total reaction=6}}
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
{{#set: completion rate=67.0}}
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: molecular weight=447.424    }}
+
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
{{#set: consumed or produced by=RXN0-5180}}
+

Revision as of 15:16, 23 May 2018

Pathway PWY0-862

  • taxonomic range:
  • common name:
    • (5Z)-dodec-5-enoate biosynthesis
  • Synonym(s):
    • (5Z)-dodecenoate biosynthesis
    • cis-dodecenoate biosynthesis

Reaction(s) found

4 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links