Difference between revisions of "CPD-14927"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == |
* smiles: | * smiles: | ||
− | ** CC | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M |
* common name: | * common name: | ||
− | ** | + | ** phytenate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 309.511 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2E-phytenate | ||
+ | ** 2E-phytenic acid | ||
+ | ** 3,7,11,15-tetramethyl-2E-hexadecenoic acid | ||
+ | ** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-480]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN66-479]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0104010024 |
− | + | ||
− | + | ||
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles=CC | + | ** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}} |
− | {{#set: molecular weight= | + | {{#set: common name=phytenate}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=309.511 }} |
+ | {{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}} | ||
+ | {{#set: consumed by=RXN66-480}} | ||
+ | {{#set: produced by=RXN66-479}} |
Revision as of 15:19, 23 May 2018
Contents
Metabolite CPD-14927
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
- inchi key:
- InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
- common name:
- phytenate
- molecular weight:
- 309.511
- Synonym(s):
- 2E-phytenate
- 2E-phytenic acid
- 3,7,11,15-tetramethyl-2E-hexadecenoic acid
- (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.