Difference between revisions of "CHC T00008766001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
(Created page with "Category:Gene == Gene CHC_T00008766001 == * left end position: ** 1826 * transcription direction: ** NEGATIVE * right end position: ** 2494 * centisome position: ** 0.8147...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Gene CHC_T00008766001 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** 1826
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** leukotriene-D4
+
** 2494
−
* molecular weight:
+
* centisome position:
−
** 495.653    
+
** 0.8147021    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GSHTRAN-RXN]]
−
* [[RXN66-336]]
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1826}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2494}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
{{#set: centisome position=0.8147021    }}
−
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
{{#set: common name=leukotriene-D4}}
+
−
{{#set: molecular weight=495.653    }}
+
−
{{#set: produced by=RXN66-336}}
+

Latest revision as of 15:20, 23 May 2018

Gene CHC_T00008766001

  • left end position:
    • 1826
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2494
  • centisome position:
    • 0.8147021
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008766001&oldid=14012"