Difference between revisions of "Fe3-siderophores"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] == * smiles: ** C=C(C(=O)[O-])OC1(CC(C(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fe3-siderophores Fe3-siderophores] == * common name: ** an Fe(III)-siderophore * Synonym(s): **...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-ENOLPYRUVYL-SHIKIMATE-5P 3-ENOLPYRUVYL-SHIKIMATE-5P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Fe3-siderophores Fe3-siderophores] ==
* smiles:
+
** C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)
+
* inchi key:
+
** InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J
+
 
* common name:
 
* common name:
** 5-enolpyruvoyl-shikimate 3-phosphate
+
** an Fe(III)-siderophore
* molecular weight:
+
** 320.149   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-enolpyruvyl-shikimate 5-phosphate
+
** an iron chelate
** 3-enolpyruvyl-shikimate-5-P
+
** a ferric siderophore
** 5-O-(1-carboxyvinyl)-3-phosphoshikimate
+
** 5-enolpyruvyl-shikimate 3-phosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CHORISMATE-SYNTHASE-RXN]]
+
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.5.1.19-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an Fe(III)-siderophore}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506801 14506801]
+
{{#set: common name=an iron chelate|a ferric siderophore}}
* CHEBI:
+
{{#set: consumed by=FERRIC-CHELATE-REDUCTASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57701 57701]
+
* BIGG : 3psme
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01269 C01269]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(CC(C(=O)[O-])=CC(OP(=O)([O-])[O-])C(O)1)}}
+
{{#set: inchi key=InChIKey=QUTYKIXIUDQOLK-PRJMDXOYSA-J}}
+
{{#set: common name=5-enolpyruvoyl-shikimate 3-phosphate}}
+
{{#set: molecular weight=320.149    }}
+
{{#set: common name=3-enolpyruvyl-shikimate 5-phosphate|3-enolpyruvyl-shikimate-5-P|5-O-(1-carboxyvinyl)-3-phosphoshikimate|5-enolpyruvyl-shikimate 3-phosphate}}
+
{{#set: consumed by=CHORISMATE-SYNTHASE-RXN}}
+
{{#set: consumed or produced by=2.5.1.19-RXN}}
+

Latest revision as of 15:25, 23 May 2018

Metabolite Fe3-siderophores

  • common name:
    • an Fe(III)-siderophore
  • Synonym(s):
    • an iron chelate
    • a ferric siderophore

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links