Difference between revisions of "CHC T00008491001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
(Created page with "Category:Gene == Gene CHC_T00008491001 == * left end position: ** 119435 * transcription direction: ** POSITIVE * right end position: ** 120643 * centisome position: ** 59...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
+
== Gene CHC_T00008491001 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
+
** 119435
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-carboxy-5α-cholesta-8-en-3β-ol
+
** 120643
−
* molecular weight:
+
* centisome position:
−
** 429.662    
+
** 59.780865    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-23]]
+
* Reaction: [[PORPHOBILSYNTH-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
* [[RXN-13710]]
+
*** Assignment: automated-name-match
−
* [[RXN66-22]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5189]]
 +
* [[PWY-5188]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=119435}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=120643}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
+
{{#set: centisome position=59.780865   }}
−
* HMDB : HMDB12166
+
{{#set: reaction associated=PORPHOBILSYNTH-RXN}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
+
{{#set: pathway associated=PWY-5189|PWY-5188}}
−
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
+
−
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
+
−
{{#set: molecular weight=429.662   }}
+
−
{{#set: consumed by=RXN66-23}}
+
−
{{#set: produced by=RXN-13710|RXN66-22}}
+

Revision as of 15:27, 23 May 2018

Gene CHC_T00008491001

  • left end position:
    • 119435
  • transcription direction:
    • POSITIVE
  • right end position:
    • 120643
  • centisome position:
    • 59.780865
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008491001&oldid=14359"