Difference between revisions of "Chalcones"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7436 PWY-7436] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3398 TAX-33...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * smiles: ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methylbutanoyl-CoA |
+ | * molecular weight: | ||
+ | ** 847.62 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** S-2-methyl-butyryl-CoA |
+ | ** 2-methylbutyryl-CoA | ||
+ | ** α-methylbutyryl-CoA | ||
+ | ** α-methylbutanoyl-CoA | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2KETO-3METHYLVALERATE-RXN]] | |
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57336 57336] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033] | ||
+ | * HMDB : HMDB01041 | ||
+ | {{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J}} | ||
+ | {{#set: common name=2-methylbutanoyl-CoA}} | ||
+ | {{#set: molecular weight=847.62 }} | ||
+ | {{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|α-methylbutyryl-CoA|α-methylbutanoyl-CoA}} | ||
+ | {{#set: consumed or produced by=2KETO-3METHYLVALERATE-RXN}} |
Revision as of 10:51, 18 January 2018
Contents
Metabolite 2-METHYL-BUTYRYL-COA
- smiles:
- CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J
- common name:
- 2-methylbutanoyl-CoA
- molecular weight:
- 847.62
- Synonym(s):
- S-2-methyl-butyryl-CoA
- 2-methylbutyryl-CoA
- α-methylbutyryl-CoA
- α-methylbutanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.