Difference between revisions of "RXN3O-130"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-130 RXN3O-130] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 3 [[NADPH]][c] '''+''' 1 [[LANOSTEROL]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 4 [[WATER]][c] '''+''' 1 [[FORMATE]][c] '''+''' 3 [[NADP]][c] '''+''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 3 NADPH[c] '''+''' 1 lanosterol[c] '''+''' 2 H+[c] '''+''' 3 oxygen[c] '''=>''' 4 H2O[c] '''+''' 1 formate[c] '''+''' 3 NADP+[c] '''+''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009303001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074] | ||
+ | ** '''10''' reactions found over '''12''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25287 25287] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05640 R05640] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: ec number=EC-1.14.13.70}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=CHC_T00009303001_1}} |
− | + | {{#set: in pathway=PWY-6074}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:28, 23 May 2018
Contents
Reaction RXN3O-130
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 3 NADPH[c] + 1 LANOSTEROL[c] + 2 PROTON[c] + 3 OXYGEN-MOLECULE[c] => 4 WATER[c] + 1 FORMATE[c] + 3 NADP[c] + 1 44-DIMETHYL-CHOLESTA-812-24-TRIENOL[c]
- With common name(s):
- 3 NADPH[c] + 1 lanosterol[c] + 2 H+[c] + 3 oxygen[c] => 4 H2O[c] + 1 formate[c] + 3 NADP+[c] + 1 4,4-dimethyl-cholesta-8,12,24-trienol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009303001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6074, zymosterol biosynthesis: PWY-6074
- 10 reactions found over 12 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links