Difference between revisions of "RXN-8042"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042] == * direction: ** LEFT-TO-RIGHT * common name: ** Carotene isomerase * ec numbe...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8042 RXN-8042] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J
+
 
* common name:
 
* common name:
−
** OPC8-3-hydroxyacyl-CoA
+
** Carotene isomerase
−
* molecular weight:
+
* ec number:
−
** 1055.92   
+
** [http://enzyme.expasy.org/EC/5.2.1.13 EC-5.2.1.13]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10698]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7496]][c] '''=>''' 1 [[CPD1F-114]][c]
−
* [[RXN-10697]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 prolycopene[c] '''=>''' 1 all-trans-lycopene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008475001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00008475001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
 +
** '''6''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237307 44237307]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30974 30974]
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=PDDHCVXPABQISO-PEUIIYGWSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07512 R07512]
−
{{#set: common name=OPC8-3-hydroxyacyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=1055.92    }}
+
{{#set: common name=Carotene isomerase}}
−
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-3-hydroxy-2-enoyl-CoA}}
+
{{#set: ec number=EC-5.2.1.13}}
−
{{#set: consumed by=RXN-10698}}
+
{{#set: gene associated=CHC_T00008475001_1|CHC_T00008475001}}
−
{{#set: produced by=RXN-10697}}
+
{{#set: in pathway=PWY-6475}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:29, 23 May 2018

Reaction RXN-8042

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Carotene isomerase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 prolycopene[c] => 1 all-trans-lycopene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
    • 6 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-8042&oldid=14473"